CAS 1159819-61-0

6-(2-Fluorophenyl)-2-methyl-4-pyrimidinamine

Description:

6-(2-Fluorophenyl)-2-methyl-4-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a 2-fluorophenyl group at the 6-position and a methyl group at the 2-position contributes to its unique properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic fluorophenyl substituent, which can influence its solubility and permeability in biological systems. The amino group at the 4-position may participate in hydrogen bonding, enhancing its potential interactions with biological targets. Such structural features suggest that it could be of interest in medicinal chemistry, possibly as a lead compound in drug development. Its specific reactivity, stability, and biological activity would depend on the context of its use, including the presence of other functional groups and the overall molecular environment. As with many pyrimidine derivatives, it may exhibit a range of pharmacological activities, warranting further investigation.

Formula: C₁₁H₁₀FN₃

InChI: InChI=1S/C11H10FN3/c1-7-14-10(6-11(13)15-7)8-4-2-3-5-9(8)12/h2-6H,1H3,(H2,13,14,15)

InChI key: InChIKey=CORQHVIALRYBEA-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1)C=2C=C(N)N=C(C)N2

Synonyms:

• 6-(2-Fluorophenyl)-2-methyl-4-pyrimidinamine
• 4-Pyrimidinamine, 6-(2-fluorophenyl)-2-methyl-