CymitQuimica logo

CAS 1159819-92-7

:

6-Cyclopentyl-4-pyrimidinamine

Description:
6-Cyclopentyl-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a cyclopentyl group at the 6-position of the pyrimidine ring contributes to its unique properties, potentially influencing its solubility and biological activity. This compound is often studied in the context of medicinal chemistry, particularly for its potential applications in pharmaceuticals, as pyrimidine derivatives are known for their diverse biological activities, including antiviral and anticancer properties. The amine functional group at the 4-position enhances its reactivity and may facilitate interactions with biological targets. Additionally, the molecular structure suggests that it may exhibit specific conformational characteristics that could affect its binding affinity and selectivity in biological systems. Overall, 6-Cyclopentyl-4-pyrimidinamine represents a class of compounds that are of interest for further research and development in drug discovery and development.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c10-9-5-8(11-6-12-9)7-3-1-2-4-7/h5-7H,1-4H2,(H2,10,11,12)
InChI key:InChIKey=JEDBWXMMQNWHDK-UHFFFAOYSA-N
SMILES:NC1=CC(=NC=N1)C2CCCC2
Synonyms:
  • 6-Cyclopentyl-4-pyrimidinamine
  • 4-Pyrimidinamine, 6-cyclopentyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.