CAS 1159819-93-8

2-Bromo-4-(3-fluorophenyl)thiophene

Description:

2-Bromo-4-(3-fluorophenyl)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 2-position and a 3-fluorophenyl group at the 4-position contributes to its unique chemical properties. This compound is likely to exhibit moderate to high reactivity due to the electrophilic nature of the bromine substituent and the electron-withdrawing effect of the fluorine atom, which can influence its reactivity in electrophilic aromatic substitution reactions. Additionally, the thiophene ring can participate in various chemical transformations, making it a versatile building block in organic synthesis. The compound may also display interesting electronic properties, potentially making it useful in applications such as organic electronics or as a precursor in the synthesis of more complex molecules. Its solubility and stability in different solvents can vary, which is important for its practical applications in laboratory and industrial settings.

Formula: C₁₀H₆BrFS

InChI: InChI=1S/C10H6BrFS/c11-10-5-8(6-13-10)7-2-1-3-9(12)4-7/h1-6H

InChI key: InChIKey=UQQUGVCPXAJHPZ-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1)C2=CSC(Br)=C2

Synonyms:

• 2-Bromo-4-(3-fluorophenyl)thiophene
• Thiophene, 2-bromo-4-(3-fluorophenyl)-

2-Bromo-4-(3-fluorophenyl)thiophene

CAS: 1159819-93-8

Versatile small molecule scaffold

Formula: C₁₀H₆BrFS

Purity: Min. 95%

Molecular weight: 257.12 g/mol

Ref: 3D-JWB81993