CAS 115982-22-4
:14-(3,4-dihydroxyphenyl)-2,3,11,12-tetrahydroxy-6a,14a-dihydro-6H-chromeno[4',3':4,5]pyrrolo[2,1-a]isoquinolin-6-one
Description:
The chemical substance known as "14-(3,4-dihydroxyphenyl)-2,3,11,12-tetrahydroxy-6a,14a-dihydro-6H-chromeno[4',3':4,5]pyrrolo[2,1-a]isoquinolin-6-one," with the CAS number 115982-22-4, is a complex organic compound characterized by its intricate polycyclic structure. It features multiple hydroxyl groups, which contribute to its potential solubility in polar solvents and may enhance its reactivity and biological activity. The presence of the chromeno and pyrroloisoquinoline frameworks suggests that this compound may exhibit interesting pharmacological properties, possibly acting as a bioactive agent. Its structural features may allow for interactions with various biological targets, making it a candidate for further research in medicinal chemistry. Additionally, the compound's unique arrangement of functional groups could influence its stability, reactivity, and potential applications in fields such as drug development or materials science. Overall, this substance represents a fascinating area of study due to its structural complexity and potential therapeutic implications.
Formula:C25H17NO8
InChI:InChI=1/C25H17NO8/c27-14-2-1-11(6-15(14)28)21-22-13-8-18(31)19(32)9-20(13)34-25(33)24(22)26-4-3-10-5-16(29)17(30)7-12(10)23(21)26/h1-9,22,24,27-32H
Synonyms:- 14-(3,4-Dihydroxyphenyl)-2,3,11,12-tetrahydroxy-6a,14a-dihydro-6H-chromeno(4',3':4,5)pyrrolo(2,1-a)isoquinolin-6-one
- 14-(3,4-Dihydroxyphenyl)-2,3,11,12-tetrahydroxy-6a,14a-dihydro-6H-chromeno[4',3':4,5]pyrrolo[2,1-a]isoquinolin-6-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lamellarin H
CAS:Lamellarin H is a benzo-isoquinoline-coumarin.Formula:C25H15NO8Color and Shape:SolidMolecular weight:457.39
