
CAS 1159820-13-9
:5-Bromo-2-(4-thiazolyl)pyridine
Description:
5-Bromo-2-(4-thiazolyl)pyridine is a heterocyclic organic compound characterized by the presence of both bromine and thiazole functional groups. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen. The bromine atom is typically positioned at the 5th carbon of the pyridine ring, contributing to the compound's reactivity and potential applications in medicinal chemistry. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly for its potential as an antimicrobial or anticancer agent. Its molecular structure allows for various interactions with biological targets, and its solubility and stability can vary depending on the solvent and conditions used. As with many heterocyclic compounds, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which can be exploited in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of bromine and the potential toxicity of thiazole derivatives.
Formula:C8H5BrN2S
InChI:InChI=1S/C8H5BrN2S/c9-6-1-2-7(10-3-6)8-4-12-5-11-8/h1-5H
InChI key:InChIKey=YTIBOJGRHQNSRD-UHFFFAOYSA-N
SMILES:BrC1=CC=C(N=C1)C2=CSC=N2
Synonyms:- Pyridine, 5-bromo-2-(4-thiazolyl)-
- 5-Bromo-2-(4-thiazolyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.