CymitQuimica logo

CAS 1159820-18-4

:

5-(5-Pyrimidinyl)-2(1H)-pyrazinone

Description:
5-(5-Pyrimidinyl)-2(1H)-pyrazinone is a chemical compound characterized by its unique heterocyclic structure, which includes both pyrimidine and pyrazinone moieties. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for many nitrogen-containing heterocycles. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in the rings can influence its reactivity and interaction with biological targets. Additionally, compounds like this may exhibit various functional properties, including potential antimicrobial or antitumor activities, although specific biological data would be necessary to confirm such effects. The compound's CAS number, 1159820-18-4, allows for precise identification and retrieval of information in chemical databases. Overall, 5-(5-Pyrimidinyl)-2(1H)-pyrazinone represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C8H6N4O
InChI:InChI=1S/C8H6N4O/c13-8-4-11-7(3-12-8)6-1-9-5-10-2-6/h1-5H,(H,12,13)
InChI key:InChIKey=REZOOMHVWLCXDL-UHFFFAOYSA-N
SMILES:O=C1NC=C(N=C1)C=2C=NC=NC2
Synonyms:
  • 2(1H)-Pyrazinone, 5-(5-pyrimidinyl)-
  • 5-(5-Pyrimidinyl)-2(1H)-pyrazinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.