CymitQuimica logo

CAS 1159820-21-9

:

2-Cyclopropyl-6-(2-pyridinyl)-4-pyrimidinamine

Description:
2-Cyclopropyl-6-(2-pyridinyl)-4-pyrimidinamine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a cyclopropyl group and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic amines, such as potential biological activity and solubility in organic solvents. The presence of the pyrimidine and pyridine rings suggests that it may engage in hydrogen bonding and π-π stacking interactions, which can influence its reactivity and interactions with biological targets. Additionally, the cyclopropyl group can impart strain and unique steric effects, potentially affecting the compound's pharmacokinetics and pharmacodynamics. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which they are measured.
Formula:C12H12N4
InChI:InChI=1S/C12H12N4/c13-11-7-10(9-3-1-2-6-14-9)15-12(16-11)8-4-5-8/h1-3,6-8H,4-5H2,(H2,13,15,16)
InChI key:InChIKey=UNDAUDOXWZJQQF-UHFFFAOYSA-N
SMILES:NC=1N=C(C2CC2)N=C(C1)C3=CC=CC=N3
Synonyms:
  • 2-Cyclopropyl-6-(2-pyridinyl)-4-pyrimidinamine
  • 4-Pyrimidinamine, 2-cyclopropyl-6-(2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.