CAS 1159820-22-0
:6-(2-Fluorophenyl)-4(3H)-pyrimidinone
Description:
6-(2-Fluorophenyl)-4(3H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core structure, which features a fluorophenyl substituent at the 6-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the fluorine atom can enhance lipophilicity and influence the compound's pharmacokinetic properties, potentially affecting its solubility and permeability. The pyrimidinone moiety may contribute to its reactivity and stability, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, 6-(2-Fluorophenyl)-4(3H)-pyrimidinone represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C10H7FN2O
InChI:InChI=1S/C10H7FN2O/c11-8-4-2-1-3-7(8)9-5-10(14)13-6-12-9/h1-6H,(H,12,13,14)
InChI key:InChIKey=VYXCZTGUYINUMO-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(=O)N=CN2)C=CC=C1
Synonyms:- 4(3H)-Pyrimidinone, 6-(2-fluorophenyl)-
- 6-(2-Fluorophenyl)-4(3H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.