CymitQuimica logo

CAS 1159820-28-6

:

4-Bromo-6-(4-pyridinyl)pyrimidine

Description:
4-Bromo-6-(4-pyridinyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at position 4 and a 4-pyridinyl substituent at position 6 contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It exhibits potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The bromine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the pyridine ring can participate in hydrogen bonding and π-π stacking interactions, which may affect the compound's overall stability and reactivity. Overall, 4-Bromo-6-(4-pyridinyl)pyrimidine is a versatile compound with applications in research and drug development, owing to its structural features and functional groups.
Formula:C9H6BrN3
InChI:InChI=1S/C9H6BrN3/c10-9-5-8(12-6-13-9)7-1-3-11-4-2-7/h1-6H
InChI key:InChIKey=HWPBAZHOBQTNPB-UHFFFAOYSA-N
SMILES:BrC1=CC(=NC=N1)C=2C=CN=CC2
Synonyms:
  • 4-Bromo-6-(4-pyridinyl)pyrimidine
  • Pyrimidine, 4-bromo-6-(4-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.