CymitQuimica logo

CAS 1159820-59-3

:

2-Bromo-4-cyclobutylthiazole

Description:
2-Bromo-4-cyclobutylthiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine atom at the second position and a cyclobutyl group at the fourth position of the thiazole ring. This structural arrangement contributes to its unique chemical properties, including potential reactivity due to the presence of the bromine substituent, which can participate in nucleophilic substitution reactions. The cyclobutyl group introduces strain and can influence the compound's overall stability and reactivity. 2-Bromo-4-cyclobutylthiazole may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, melting point, and other physical properties would depend on the specific interactions of its functional groups and the overall molecular structure. As with many thiazole derivatives, it may also show potential as a building block in the synthesis of more complex organic molecules.
Formula:C7H8BrNS
InChI:InChI=1S/C7H8BrNS/c8-7-9-6(4-10-7)5-2-1-3-5/h4-5H,1-3H2
InChI key:InChIKey=HZLZIOSFAYISDN-UHFFFAOYSA-N
SMILES:BrC1=NC(=CS1)C2CCC2
Synonyms:
  • 2-Bromo-4-cyclobutylthiazole
  • Thiazole, 2-bromo-4-cyclobutyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.