CAS 1159820-75-3

2-Bromo-6-(3-pyrrolidinyl)pyridine

Description:

2-Bromo-6-(3-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2 and 6 positions. The presence of a bromine atom at the 2-position introduces significant reactivity, making it a useful intermediate in various organic synthesis reactions. The 3-pyrrolidinyl group at the 6-position contributes to its potential biological activity, as pyrrolidine derivatives are often associated with pharmacological properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's reactivity can be exploited in coupling reactions or further functionalization, making it valuable in synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Bromo-6-(3-pyrrolidinyl)pyridine is a versatile compound with implications in both research and industrial applications.

Formula: C₉H₁₁BrN₂

InChI: InChI=1S/C9H11BrN2/c10-9-3-1-2-8(12-9)7-4-5-11-6-7/h1-3,7,11H,4-6H2

InChI key: InChIKey=HBVGYHNKCKMQOQ-UHFFFAOYSA-N

SMILES: BrC1=NC(=CC=C1)C2CCNC2

Synonyms:

• 2-Bromo-6-(3-pyrrolidinyl)pyridine
• Pyridine, 2-bromo-6-(3-pyrrolidinyl)-