
CAS 1159820-76-4
:6-(3-Thienyl)-3-pyridinol
Description:
6-(3-Thienyl)-3-pyridinol is an organic compound characterized by its unique structure, which features a pyridine ring substituted with a thienyl group. This compound typically exhibits properties associated with both heterocyclic systems, including potential aromaticity and reactivity due to the presence of nitrogen and sulfur atoms in its structure. The thienyl group contributes to the compound's electronic properties, potentially enhancing its ability to participate in various chemical reactions, such as electrophilic substitutions or coordination with metal ions. Additionally, 6-(3-Thienyl)-3-pyridinol may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and industry. Overall, this compound represents a fascinating intersection of chemistry and potential pharmacological applications, warranting further investigation into its properties and uses.
Formula:C9H7NOS
InChI:InChI=1S/C9H7NOS/c11-8-1-2-9(10-5-8)7-3-4-12-6-7/h1-6,11H
InChI key:InChIKey=DHAKZGQGRYUOMJ-UHFFFAOYSA-N
SMILES:OC1=CC=C(N=C1)C=2C=CSC2
Synonyms:- 6-(3-Thienyl)-3-pyridinol
- 3-Pyridinol, 6-(3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.