CymitQuimica logo

CAS 1159821-12-1

:

6-(2-Furanyl)-3-pyridinol

Description:
6-(2-Furanyl)-3-pyridinol is an organic compound characterized by the presence of both a pyridine and a furan ring in its structure. The compound features a hydroxyl group (-OH) attached to the pyridine ring, which contributes to its potential as a weak acid. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the furan moiety can also impart unique electronic properties, potentially affecting the compound's behavior in chemical reactions. Additionally, the compound's stability, melting point, and boiling point can vary based on environmental conditions and the presence of other substances. Overall, 6-(2-Furanyl)-3-pyridinol is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C9H7NO2
InChI:InChI=1S/C9H7NO2/c11-7-3-4-8(10-6-7)9-2-1-5-12-9/h1-6,11H
InChI key:InChIKey=RFJAXTWRVNSADK-UHFFFAOYSA-N
SMILES:OC1=CC=C(N=C1)C2=CC=CO2
Synonyms:
  • 3-Pyridinol, 6-(2-furanyl)-
  • 6-(2-Furanyl)-3-pyridinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.