CAS 1159821-14-3

5-Bromo-N-cyclopropyl-2-pyrazinamine

Description:

5-Bromo-N-cyclopropyl-2-pyrazinamine is a chemical compound characterized by its unique structure, which includes a pyrazinamine core substituted with a bromine atom and a cyclopropyl group. This compound belongs to the class of pyrazine derivatives, which are known for their diverse biological activities. The presence of the bromine atom typically enhances the compound's reactivity and may influence its pharmacological properties. The cyclopropyl group can impart strain and unique steric effects, potentially affecting the compound's interaction with biological targets. In terms of solubility, compounds of this nature often exhibit moderate solubility in organic solvents, while their solubility in water can vary based on the specific functional groups present. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a candidate for further research in various chemical and pharmaceutical contexts.

Formula: C₇H₈BrN₃

InChI: InChI=1S/C7H8BrN3/c8-6-3-10-7(4-9-6)11-5-1-2-5/h3-5H,1-2H2,(H,10,11)

InChI key: InChIKey=MEJZURLNWLFKQW-UHFFFAOYSA-N

SMILES: N(C1CC1)C=2C=NC(Br)=CN2

Synonyms:

• 2-Pyrazinamine, 5-bromo-N-cyclopropyl-
• 5-Bromo-N-cyclopropyl-2-pyrazinamine