CAS 1159821-30-3
:2-(Tetrahydro-2H-pyran-4-yl)-4-pyrimidinamine
Description:
2-(Tetrahydro-2H-pyran-4-yl)-4-pyrimidinamine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a tetrahydropyran moiety. The presence of the pyrimidine ring contributes to its potential biological activity, as pyrimidines are often found in nucleic acids and various pharmaceuticals. The tetrahydropyran group adds a cyclic ether component, which can influence the compound's solubility and reactivity. This compound may exhibit properties such as moderate polarity due to the presence of nitrogen and oxygen atoms, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. The compound's CAS number, 1159821-30-3, allows for easy identification in chemical databases and literature. Overall, the combination of its functional groups and ring structures makes it a compound of interest for further research and development in various chemical and pharmaceutical applications.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c10-8-1-4-11-9(12-8)7-2-5-13-6-3-7/h1,4,7H,2-3,5-6H2,(H2,10,11,12)
InChI key:InChIKey=HUFXKJVKRFXSCU-UHFFFAOYSA-N
SMILES:NC1=NC(=NC=C1)C2CCOCC2
Synonyms:- 4-Pyrimidinamine, 2-(tetrahydro-2H-pyran-4-yl)-
- 2-(Oxan-4-yl)pyrimidin-4-amine
- 2-(Tetrahydro-2H-pyran-4-yl)-4-pyrimidinamine
- 2-(Tetrahydro-pyran-4-yl)-pyrimidin-4-ylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
