CAS 1159821-51-8

2-(3-Pyridinyl)-5-thiazolamine

Description:

2-(3-Pyridinyl)-5-thiazolamine is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thiazole moiety. This compound typically exhibits properties associated with both heterocyclic aromatic compounds and amines. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, due to the presence of the thiazole and pyridine groups, which can interact with various biological targets. The compound is likely to be soluble in polar organic solvents, and its reactivity may include participation in nucleophilic substitution and condensation reactions. Additionally, the presence of the amino group can facilitate hydrogen bonding, influencing its solubility and interaction with other molecules. As with many heterocyclic compounds, the specific characteristics such as melting point, boiling point, and spectral properties would depend on the purity and specific conditions under which the compound is analyzed. Overall, 2-(3-Pyridinyl)-5-thiazolamine represents a class of compounds with significant interest in medicinal chemistry and drug development.

Formula: C₈H₇N₃S

InChI: InChI=1S/C8H7N3S/c9-7-5-11-8(12-7)6-2-1-3-10-4-6/h1-5H,9H2

InChI key: InChIKey=MUNKBMPBTNZCTE-UHFFFAOYSA-N

SMILES: NC=1SC(=NC1)C=2C=CC=NC2

Synonyms:

• 2-(Pyridin-3-yl)-1,3-thiazol-5-amine
• 2-(3-Pyridinyl)-5-thiazolamine
• 5-Thiazolamine, 2-(3-pyridinyl)-