CAS 1159821-52-9
:1-(6-Amino-4-pyrimidinyl)-3-piperidinol
Description:
1-(6-Amino-4-pyrimidinyl)-3-piperidinol, identified by its CAS number 1159821-52-9, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a piperidinol moiety. The presence of an amino group on the pyrimidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the functional groups present. Its molecular structure suggests potential interactions with biological targets, possibly acting as a pharmacophore in drug development. The compound may also display basicity due to the piperidine nitrogen, which can participate in hydrogen bonding and ionic interactions. Overall, 1-(6-Amino-4-pyrimidinyl)-3-piperidinol is a versatile compound with implications in pharmaceutical research, particularly in the development of therapeutics targeting various diseases. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C9H14N4O
InChI:InChI=1S/C9H14N4O/c10-8-4-9(12-6-11-8)13-3-1-2-7(14)5-13/h4,6-7,14H,1-3,5H2,(H2,10,11,12)
InChI key:InChIKey=VICAIURTPZPLPL-UHFFFAOYSA-N
SMILES:NC1=CC(=NC=N1)N2CC(O)CCC2
Synonyms:- 3-Piperidinol, 1-(6-amino-4-pyrimidinyl)-
- 1-(6-Amino-4-pyrimidinyl)-3-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.