CAS 1159821-66-5

6-Cyclopropyl-3-pyridinamine

Description:

6-Cyclopropyl-3-pyridinamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a cyclopropyl group, a three-membered carbon ring, at the 6-position of the pyridine structure contributes to its unique properties. This compound is typically classified as an amine due to the presence of an amino group (-NH2) at the 3-position of the pyridine ring. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as modifications to the pyridine and cyclopropyl groups can influence biological activity and binding affinity. Additionally, the compound's solubility, stability, and reactivity can be affected by the electronic and steric effects of the substituents. While specific physical and chemical properties such as melting point, boiling point, and solubility may vary, the overall characteristics of 6-Cyclopropyl-3-pyridinamine make it a compound of interest in various chemical research fields.

Formula: C₈H₁₀N₂

InChI: InChI=1S/C8H10N2/c9-7-3-4-8(10-5-7)6-1-2-6/h3-6H,1-2,9H2

InChI key: InChIKey=UHKKTHBJHSUSEZ-UHFFFAOYSA-N

SMILES: NC1=CC=C(C2CC2)N=C1

3-Pyridinamine, 6-cyclopropyl-

CAS: 1159821-66-5

Formula: C₈H₁₀N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.1784

Ref: IN-DA000HA6

6-Cyclopropylpyridin-3-amine

CAS: 1159821-66-5

6-Cyclopropylpyridin-3-amine

Formula: C₈H₁₀N₂

Purity: ≥95%

Color and Shape: brown and white to gray mix crystals

Molecular weight: 134.18g/mol

Ref: 54-OR306607

6-Cyclopropylpyridin-3-amine

CAS: 1159821-66-5

Formula: C₈H₁₀N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 134.182

Ref: 10-F323857

6-Cyclopropylpyridin-3-amine

CAS: 1159821-66-5

Versatile small molecule scaffold

Formula: C₈H₁₀N₂

Purity: Min. 95%

Molecular weight: 134.18 g/mol

Ref: 3D-JWB82166