CAS 1159821-68-7

2-[2-(Trifluoromethyl)phenyl]thiazole

Description:

2-[2-(Trifluoromethyl)phenyl]thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a trifluoromethyl group (-CF3) attached to a phenyl ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically used in various applications, including pharmaceuticals and agrochemicals, due to its unique electronic and steric properties. The trifluoromethyl group can also impart increased stability and resistance to metabolic degradation. In terms of physical properties, compounds like this often exhibit moderate to high melting points and solubility in organic solvents. Additionally, the thiazole moiety can participate in various chemical reactions, making it a versatile building block in synthetic chemistry. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks. Overall, 2-[2-(Trifluoromethyl)phenyl]thiazole is a notable compound in the field of medicinal chemistry and materials science.

Formula: C₁₀H₆F₃NS

InChI: InChI=1S/C10H6F3NS/c11-10(12,13)8-4-2-1-3-7(8)9-14-5-6-15-9/h1-6H

InChI key: InChIKey=RJFWGEQFRVBBDT-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C=CC=C1)C2=NC=CS2

Synonyms:

• Thiazole, 2-[2-(trifluoromethyl)phenyl]-
• 2-[2-(Trifluoromethyl)phenyl]thiazole