CAS 1159822-14-6
:4-(4-Piperidinyl)-2-pyridinamine
Description:
4-(4-Piperidinyl)-2-pyridinamine, also known by its CAS number 1159822-14-6, is a chemical compound characterized by its unique structure, which includes a piperidine ring and a pyridine moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of nitrogen atoms. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to its amine functional groups. The presence of both piperidine and pyridine rings suggests that it may have interesting pharmacological properties, potentially acting as a ligand for various biological targets. Additionally, the compound may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry for the development of new therapeutic agents. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H15N3
InChI:InChI=1S/C10H15N3/c11-10-7-9(3-6-13-10)8-1-4-12-5-2-8/h3,6-8,12H,1-2,4-5H2,(H2,11,13)
InChI key:InChIKey=GHSMUAABTWCKTQ-UHFFFAOYSA-N
SMILES:NC1=CC(=CC=N1)C2CCNCC2
Synonyms:- 4-(4-Piperidinyl)-2-pyridinamine
- 2-Pyridinamine, 4-(4-piperidinyl)-
- 4-(Piperidin-4-yl)pyridin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
