CAS 1159822-25-9

3-Pyridinecarboxaldehyde, 4-amino-, hydrochloride (1:2)

Description:

3-Pyridinecarboxaldehyde, 4-amino-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an aldehyde functional group (-CHO) at the 3-position and an amino group (-NH2) at the 4-position of the pyridine ring, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which enhances its solubility in water and may influence its stability and bioavailability. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular interactions can be influenced by the presence of the amino and aldehyde groups, making it a candidate for various chemical reactions, including condensation and substitution reactions. As with many nitrogen-containing heterocycles, it may also display biological activity, warranting further investigation in drug development contexts.

Formula: C₆H₆N₂O·2ClH

InChI: InChI=1S/C6H6N2O.2ClH/c7-6-1-2-8-3-5(6)4-9;;/h1-4H,(H2,7,8);2*1H

InChI key: InChIKey=LBYBDQWKNONIEA-UHFFFAOYSA-N

SMILES: C(=O)C=1C(N)=CC=NC1.Cl

Synonyms:

• 3-Pyridinecarboxaldehyde, 4-amino-, hydrochloride (1:2)