
CAS 1159822-30-6
:2(1H)-Isoquinolinecarboxylic acid, 6-amino-3,4-dihydro-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Description:
2(1H)-Isoquinolinecarboxylic acid, 6-amino-3,4-dihydro-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound featuring a fused benzene and pyridine ring. This substance contains a carboxylic acid functional group, an amino group, and an ester moiety, contributing to its potential biological activity. The presence of the 1,1-dimethylethyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as anti-inflammatory or analgesic effects, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C14H20N2O2·ClH
InChI:InChI=1S/C14H20N2O2.ClH/c1-14(2,3)18-13(17)16-7-6-10-8-12(15)5-4-11(10)9-16;/h4-5,8H,6-7,9,15H2,1-3H3;1H
InChI key:InChIKey=KMZVJJZOOPXADV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC=2C(CC1)=CC(N)=CC2.Cl
Synonyms:- 2(1H)-Isoquinolinecarboxylic acid, 6-amino-3,4-dihydro-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 6-amino-3,4-dihydroisoquinoline-2(1H)-carboxylate hydrochloride
CAS:Formula:C14H21ClN2O2Molecular weight:284.7817
