CAS 1159822-63-5

4-Isoquinolinamine, 5,6,7,8-tetrahydro-, hydrochloride (1:2)

Description:

4-Isoquinolinamine, 5,6,7,8-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound consisting of a benzene ring fused to a pyridine ring. This specific derivative features a tetrahydroisoquinoline moiety, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The hydrochloride designation signifies that the compound is in its salt form, typically enhancing its solubility in water and stability. The presence of the amine functional group suggests potential basicity and reactivity, making it of interest in medicinal chemistry for its potential biological activities. Compounds of this nature may exhibit various pharmacological properties, including effects on the central nervous system or other therapeutic applications. As with many organic compounds, its physical properties, such as melting point, solubility, and spectral characteristics, would be influenced by its molecular structure and the presence of the hydrochloride salt. Safety and handling precautions should be observed due to the potential biological activity of the compound.

Formula: C₉H₁₂N₂·2ClH

InChI: InChI=1S/C9H12N2.2ClH/c10-9-6-11-5-7-3-1-2-4-8(7)9;;/h5-6H,1-4,10H2;2*1H

InChI key: InChIKey=AMICCZAOQODLCZ-UHFFFAOYSA-N

SMILES: NC1=C2C(=CN=C1)CCCC2.Cl

Synonyms:

• 4-Isoquinolinamine, 5,6,7,8-tetrahydro-, hydrochloride (1:2)