CymitQuimica logo

CAS 1159823-05-8

:

1,8-Naphthyridine-2-acetic acid, 5,6,7,8-tetrahydro-, methyl ester, hydrochloride (1:1)

Description:
1,8-Naphthyridine-2-acetic acid, 5,6,7,8-tetrahydro-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its naphthyridine core structure, which is a bicyclic aromatic compound containing nitrogen atoms. This substance features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its unique chemical properties. The methyl ester functional group suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid, while the hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water. This compound may exhibit biological activity, potentially making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and stability. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and related fields.
Formula:C11H14N2O2·ClH
InChI:InChI=1S/C11H14N2O2.ClH/c1-15-10(14)7-9-5-4-8-3-2-6-12-11(8)13-9;/h4-5H,2-3,6-7H2,1H3,(H,12,13);1H
InChI key:InChIKey=JHWBGKHBEKOBSS-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C=1NC=2C(=CC1)CCCN2.Cl
Synonyms:
  • 1,8-Naphthyridine-2-acetic acid, 5,6,7,8-tetrahydro-, methyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.