CymitQuimica logo

CAS 1159823-51-4

:

1H-Isoindole-5-carbonitrile, 2,3-dihydro-, hydrochloride (1:1)

Description:
1H-Isoindole-5-carbonitrile, 2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its isoindole structure, which features a bicyclic arrangement of carbon atoms with a nitrogen atom incorporated into the ring. This compound typically exhibits properties associated with both isoindoles and nitriles, including potential biological activity and solubility in polar solvents due to the presence of the hydrochloride salt form. The hydrochloride designation indicates that the compound is in a salt form, which often enhances its stability and solubility in aqueous solutions. The presence of the carbonitrile functional group suggests potential reactivity, particularly in nucleophilic addition reactions. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could contribute to various pharmacological activities. As with many organic compounds, its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and usage guidelines.
Formula:C9H8N2·ClH
InChI:InChI=1S/C9H8N2.ClH/c10-4-7-1-2-8-5-11-6-9(8)3-7;/h1-3,11H,5-6H2;1H
InChI key:InChIKey=DIGADCVKPVECTM-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(=CC1)CNC2.Cl
Synonyms:
  • 1H-Isoindole-5-carbonitrile, 2,3-dihydro-, hydrochloride (1:1)
Found 5 products.