CAS 1159823-54-7

Benzaldehyde, 4-(1-piperazinyl)-, hydrochloride (1:1)

Description:

Benzaldehyde, 4-(1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzaldehyde moiety and a piperazine ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, reflecting its polar nature due to the presence of the piperazine group. The hydrochloride form indicates that it is a salt, which enhances its solubility and stability. It is often used in pharmaceutical research and development, particularly in the synthesis of various bioactive compounds. The piperazine ring contributes to its potential pharmacological properties, including anxiolytic and antidepressant effects. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Proper storage conditions are also essential to maintain its integrity and prevent degradation. Overall, this compound is of interest in medicinal chemistry due to its unique structural features and potential applications.

Formula: C₁₁H₁₄N₂O·ClH

InChI: InChI=1S/C11H14N2O.ClH/c14-9-10-1-3-11(4-2-10)13-7-5-12-6-8-13;/h1-4,9,12H,5-8H2;1H

InChI key: InChIKey=JGMXWASPZKBADJ-UHFFFAOYSA-N

SMILES: C(=O)C1=CC=C(C=C1)N2CCNCC2.Cl

Synonyms:

• Benzaldehyde, 4-(1-piperazinyl)-, hydrochloride (1:1)

4-(Piperazin-1-yl)Benzaldehyde Hydrochloride

CAS: 1159823-54-7

4-(Piperazin-1-yl)Benzaldehyde Hydrochloride

Purity: 95%

Molecular weight: 226.7g/mol

Ref: 54-OR1025064