CAS 1159823-86-5

1,1-Dimethylethyl 4-[4-(aminocarbonyl)-2-pyridinyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[4-(aminocarbonyl)-2-pyridinyl]-1-piperazinecarboxylate, identified by its CAS number 1159823-86-5, is a chemical compound that features a complex structure incorporating a piperazine ring, a pyridine moiety, and a carboxylate functional group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the aminocarbonyl group suggests it may participate in hydrogen bonding and other interactions, influencing its solubility and reactivity. The dimethyl substituents on the ethyl group contribute to steric hindrance, which can affect the compound's binding affinity to biological targets. Additionally, the piperazine ring is known for its role in various drug designs, particularly in central nervous system agents. Overall, this compound's unique structural features may provide insights into its potential applications in drug development and therapeutic interventions.

Formula: C₁₅H₂₂N₄O₃

InChI: InChI=1S/C15H22N4O3/c1-15(2,3)22-14(21)19-8-6-18(7-9-19)12-10-11(13(16)20)4-5-17-12/h4-5,10H,6-9H2,1-3H3,(H2,16,20)

InChI key: InChIKey=IANGWKTZPQMOGJ-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1C=C(N=CC1)N2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1-Piperazinecarboxylic acid, 4-[4-(aminocarbonyl)-2-pyridinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[4-(aminocarbonyl)-2-pyridinyl]-1-piperazinecarboxylate

1-N-Boc-4-(4-Carbamoylpyridin-2-yl)piperazine

CAS: 1159823-86-5

Formula: C₁₅H₂₂N₄O₃

Purity: 97.0%

Molecular weight: 306.366

Ref: 10-F048498