
CAS 1159824-37-9: 5,8-Diazaspiro[3.5]nonane, hydrochloride (1:2)
Description:5,8-Diazaspiro[3.5]nonane, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework containing two nitrogen atoms in its rings. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the diaza moiety contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The spiro structure often imparts distinctive conformational properties, influencing its interaction with biological targets. As a hydrochloride salt, it is generally more stable and easier to work with compared to its free base form. The compound's CAS number, 1159824-37-9, allows for precise identification in chemical databases. While specific applications may vary, compounds of this nature are often explored for their potential in drug development, particularly in the context of neuropharmacology or as scaffolds for synthesizing more complex molecules.
Formula:C7H14N2·2ClH
InChI:InChI=1S/C7H14N2.2ClH/c1-2-7(3-1)6-8-4-5-9-7;;/h8-9H,1-6H2;2*1H
InChI key:InChIKey=ZPIFZUKPOVZOCR-UHFFFAOYSA-N
SMILES:Cl.N1CCNC2(C1)CCC2
- Synonyms:
- 5,8-Diazaspiro[3.5]nonane dihydrochloride
- 5,8-Diazaspiro[3.5]nonane, hydrochloride (1:2)

5,8-Diaza-spiro[3.5]nonane dihydrochloride
Ref: 10-F040509
1g | 362.00 € | ||
250mg | 102.00 € |

5,8-Diazaspiro[3.5]nonane, hydrochloride (1:2)
Ref: IN-DA000HC0
100mg | 66.00 € | ||
250mg | 126.00 € |

5,8-Diaza-spiro[3.5]nonane dihydrochloride
Ref: 3D-JWB82437
250mg | 423.00 € | ||
2500mg | 1,518.00 € |