CymitQuimica logo

CAS 1159824-40-4

:

1-Pyrrolidinepropanamine, β-(4-chlorophenyl)-, hydrochloride (1:2)

Description:
1-Pyrrolidinepropanamine, β-(4-chlorophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a propanamine chain substituted with a 4-chlorophenyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the 4-chlorophenyl moiety suggests potential biological activity, as halogenated phenyl groups are often associated with pharmacological properties. The compound may exhibit basic characteristics due to the amine functional group, allowing it to participate in protonation reactions. Its molecular structure indicates potential uses in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system or other biological pathways. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through empirical studies and safety assessments. As with any chemical substance, proper safety protocols should be followed when handling this compound in laboratory or industrial settings.
Formula:C13H19ClN2·2ClH
InChI:InChI=1S/C13H19ClN2.2ClH/c14-13-5-3-11(4-6-13)12(9-15)10-16-7-1-2-8-16;;/h3-6,12H,1-2,7-10,15H2;2*1H
InChI key:InChIKey=XOGVXKCIWYATHX-UHFFFAOYSA-N
SMILES:C(CN1CCCC1)(CN)C2=CC=C(Cl)C=C2.Cl
Synonyms:
  • 1-Pyrrolidinepropanamine, β-(4-chlorophenyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.