CymitQuimica logo

CAS 1159825-57-6

:

1H-Isoindole-4-carbonitrile, 2,3-dihydro-, hydrochloride (1:1)

Description:
1H-Isoindole-4-carbonitrile, 2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its isoindole structure, which features a bicyclic framework consisting of a five-membered ring fused to a six-membered ring. The presence of a carbonitrile group indicates that it contains a cyano functional group (-C≡N), contributing to its reactivity and potential applications in organic synthesis. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, which can enhance its solubility in water and influence its stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular properties, such as melting point, solubility, and spectral characteristics, would be essential for understanding its behavior in various chemical environments. Additionally, the compound's CAS number, 1159825-57-6, serves as a unique identifier for regulatory and safety information, facilitating its use in research and industry.
Formula:C9H8N2·ClH
InChI:InChI=1S/C9H8N2.ClH/c10-4-7-2-1-3-8-5-11-6-9(7)8;/h1-3,11H,5-6H2;1H
InChI key:InChIKey=XVJQMFRHWPSTDY-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(CNC2)=CC=C1.Cl
Synonyms:
  • 2,3-Dihydro-1H-isoindole-4-carbonitrile hydrochloride
  • 1H-Isoindole-4-carbonitrile, 2,3-dihydro-, hydrochloride (1:1)
  • 1H-Isoindole-4-carbonitrile 2,3-dihydro-, hydrochloride (1:1)
  • 4-Cyanoisoindoline hydrochloride
Found 4 products.