CAS 1159826-42-2

Pyridazine, 3-chloro-5-methyl-, hydrochloride (1:2)

Description:

Pyridazine, 3-chloro-5-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a methyl group at the 5-position contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. Safety data and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, pyridazine derivatives are valuable in research and development, particularly in the synthesis of novel compounds with desired biological activities.

Formula: C₅H₅ClN₂·2ClH

InChI: InChI=1S/C5H5ClN2.2ClH/c1-4-2-5(6)8-7-3-4;;/h2-3H,1H3;2*1H

InChI key: InChIKey=LDKHJRCWLBEIPN-UHFFFAOYSA-N

SMILES: CC=1C=C(Cl)N=NC1.Cl

Synonyms:

• Pyridazine, 3-chloro-5-methyl-, hydrochloride (1:2)