CAS 1159826-45-5

1-Piperazinecarboxylic acid, 2-methyl-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1)

Description:

1-Piperazinecarboxylic acid, 2-methyl-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its piperazine and fluorenylmethyl moieties, which contribute to its unique properties. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. The piperazine ring provides basicity, allowing it to interact with various biological targets, while the fluorenylmethyl group enhances lipophilicity, potentially influencing its pharmacokinetic profile. The presence of the carboxylic acid functional group suggests that it may participate in acid-base reactions, and its ester functionality indicates potential for hydrolysis under certain conditions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could facilitate interactions with biological systems. As with many chemical substances, safety data and handling precautions should be observed, given its potential biological activity.

Formula: C₂₀H₂₂N₂O₂·ClH

InChI: InChI=1S/C20H22N2O2.ClH/c1-14-12-21-10-11-22(14)20(23)24-13-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19;/h2-9,14,19,21H,10-13H2,1H3;1H

InChI key: InChIKey=VVCUZMZSBHXCNI-UHFFFAOYSA-N

SMILES: C(OC(=O)N1C(C)CNCC1)C2C=3C(C=4C2=CC=CC4)=CC=CC3.Cl

Synonyms:

• 1-Piperazinecarboxylic acid, 2-methyl-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1)

(9H-Fluoren-9-yl)methyl 2-methylpiperazine-1-carboxylate hydrochloride

CAS: 1159826-45-5

Formula: C₂₀H₂₃ClN₂O₂

Molecular weight: 358.8618

Ref: IN-DA000HCQ