CAS 1159826-57-9

3-Piperidinone, 2-ethyl-, hydrochloride (1:1)

Description:

3-Piperidinone, 2-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone structure, which includes a six-membered ring containing nitrogen and a ketone functional group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it useful in various applications, particularly in pharmaceuticals and organic synthesis. The presence of the ethyl group at the second position of the piperidinone ring influences its chemical reactivity and biological activity. As a hydrochloride, it is often more stable and easier to handle than its free base form. The compound may exhibit properties such as basicity due to the nitrogen atom in the ring, and it can participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Its specific applications may vary, but it is generally of interest in medicinal chemistry for the development of potential therapeutic agents. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₁₃NO·ClH

InChI: InChI=1S/C7H13NO.ClH/c1-2-6-7(9)4-3-5-8-6;/h6,8H,2-5H2,1H3;1H

InChI key: InChIKey=RKYYSPXEELHYRU-UHFFFAOYSA-N

SMILES: C(C)C1C(=O)CCCN1.Cl

Synonyms:

• 3-Piperidinone, 2-ethyl-, hydrochloride (1:1)

2-Ethyl-piperidin-3-one, HCl

CAS: 1159826-57-9

Formula: C₇H₁₄ClNO

Purity: 95%

Molecular weight: 163.6452

Ref: IN-DA000HCN

2-Ethyl-piperidin-3-one hydrochloride

CAS: 1159826-57-9

Formula: C₇H₁₄ClNO

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 163.65

Ref: 10-F040235