CAS 1159826-67-1

3-N-Boc-Aminomethylpiperidine.HCL

Description:

3-N-Boc-Aminomethylpiperidine hydrochloride, identified by its CAS number 1159826-67-1, is a chemical compound characterized by its piperidine structure, which features a Boc (tert-butyloxycarbonyl) protecting group on the nitrogen atom. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules, due to its ability to serve as a versatile building block. The presence of the hydrochloride salt form enhances its solubility in polar solvents, making it easier to handle in various chemical reactions. The Boc group provides protection for the amine during synthetic procedures, allowing for selective reactions without affecting the amine functionality. In terms of physical properties, it is generally a white to off-white crystalline solid. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices are followed.

Formula: C₁₁H₂₃ClN₂O₂

InChI: InChI=1S/C11H22N2O2.ClH/c1-11(2,3)15-10(14)13-8-9-5-4-6-12-7-9;/h9,12H,4-8H2,1-3H3,(H,13,14);1H

SMILES: CC(C)(C)OC(=NCC1CCCNC1)O.Cl

Synonyms:

• 2-Methyl-2-propanyl (3-piperidinylmethyl)carbamate hydrochloride (1:1)

3-N-Boc-aminomethyl piperidine-hcl

CAS: 1159826-67-1

Formula: C₁₁H₂₃ClN₂O₂

Purity: 97%

Molecular weight: 250.7655

Ref: IN-DA000HCJ

tert-Butyl (piperidin-3-ylmethyl)carbamate hydrochloride

CAS: 1159826-67-1

tert-Butyl (piperidin-3-ylmethyl)carbamate hydrochloride

Purity: 95%

Molecular weight: 250.77g/mol

Ref: 54-OR90333