CAS 1159826-69-3

1,1-Dimethylethyl N-(cyanocyclopentylmethyl)carbamate

Description:

1,1-Dimethylethyl N-(cyanocyclopentylmethyl)carbamate, identified by its CAS number 1159826-69-3, is a chemical compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is further connected to an alkyl or aryl group. The presence of the dimethyl group indicates that it has two methyl groups attached to the carbon atom adjacent to the nitrogen. The cyanocyclopentylmethyl moiety suggests that the compound contains a cyclopentane ring with a cyanide group, which can influence its reactivity and biological activity. Generally, carbamates can exhibit a range of properties, including potential use as pesticides or pharmaceuticals, depending on their specific structure. The stability, solubility, and reactivity of this compound would be influenced by its functional groups and overall molecular structure, making it of interest in various chemical and biological applications.

Formula: C₁₂H₂₀N₂O₂

InChI: InChI=1S/C12H20N2O2/c1-12(2,3)16-11(15)14-10(8-13)9-6-4-5-7-9/h9-10H,4-7H2,1-3H3,(H,14,15)

InChI key: InChIKey=OQTNMAOGVPWMIA-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(C#N)C1CCCC1

Synonyms:

• Carbamic acid, N-(cyanocyclopentylmethyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(cyanocyclopentylmethyl)carbamate