CAS 1159831-08-9

7-Fluoro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylic acid

Description:

7-Fluoro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its unique triazole and pyridine ring structures. This compound features a fluorine atom at the 7-position of the triazole ring, which can influence its electronic properties and reactivity. The carboxylic acid functional group at the 3-position contributes to its acidity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications. The presence of both nitrogen and fluorine atoms in its structure may enhance its biological activity, potentially making it useful in pharmaceutical research. Its molecular structure allows for interactions with biological targets, which is of interest in drug development. Additionally, the compound's solubility and stability can be influenced by the functional groups present, affecting its behavior in different solvents and environments. Overall, 7-Fluoro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylic acid is a compound of interest in medicinal chemistry and material science due to its distinctive structural features and potential applications.

Formula: C₇H₄FN₃O₂

InChI: InChI=1S/C7H4FN3O2/c8-4-1-2-11-5(3-4)9-10-6(11)7(12)13/h1-3H,(H,12,13)

InChI key: InChIKey=SKKRDQZMVSBUGI-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NN1)C=C(F)C=C2

Synonyms:

• 7-Fluoro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylic acid
• 1,2,4-Triazolo[4,3-a]pyridine-3-carboxylic acid, 7-fluoro-