CymitQuimica logo

CAS 1159878-02-0

:

1-Oxazolo[4,5-b]pyridin-2-ylcyclopropanamine

Description:
1-Oxazolo[4,5-b]pyridin-2-ylcyclopropanamine is a heterocyclic compound featuring a fused oxazole and pyridine ring system, along with a cyclopropanamine moiety. This compound is characterized by its unique structural arrangement, which contributes to its potential biological activity. The presence of the oxazole ring imparts certain electronic properties, while the pyridine ring can participate in various interactions due to its nitrogen atom. The cyclopropanamine group adds to the compound's three-dimensional structure, potentially influencing its reactivity and binding properties. Such compounds are often investigated for their pharmacological potential, including roles in medicinal chemistry as potential drug candidates. The specific characteristics, such as solubility, stability, and reactivity, can vary based on the substituents and the overall molecular conformation. Additionally, the compound's CAS number, 1159878-02-0, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and material science.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c10-9(3-4-9)8-12-7-6(13-8)2-1-5-11-7/h1-2,5H,3-4,10H2
InChI key:InChIKey=LFADUJUELWKYCS-UHFFFAOYSA-N
SMILES:NC1(CC1)C2=NC=3C(O2)=CC=CN3
Synonyms:
  • 1-Oxazolo[4,5-b]pyridin-2-ylcyclopropanamine
  • Cyclopropanamine, 1-oxazolo[4,5-b]pyridin-2-yl-
  • 1-[[1,3]Oxazolo[4,5-b]pyridin-2-yl]cyclopropan-1-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.