
CAS 1159878-09-7
:2-(1-Aminocyclopropyl)-4-pyrimidinamine
Description:
2-(1-Aminocyclopropyl)-4-pyrimidinamine, identified by its CAS number 1159878-09-7, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a cyclopropyl group. This compound typically exhibits properties associated with both amines and heterocyclic compounds, making it of interest in medicinal chemistry. The presence of the amino group contributes to its potential as a ligand in biological systems, possibly influencing its interaction with various receptors or enzymes. Its molecular structure suggests it may participate in hydrogen bonding, which can affect its solubility and reactivity. Additionally, the cyclopropyl moiety may impart strain, influencing the compound's stability and reactivity. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature often exhibit moderate to high polarity, which can affect their pharmacokinetic profiles. Overall, 2-(1-Aminocyclopropyl)-4-pyrimidinamine represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C7H10N4
InChI:InChI=1S/C7H10N4/c8-5-1-4-10-6(11-5)7(9)2-3-7/h1,4H,2-3,9H2,(H2,8,10,11)
InChI key:InChIKey=XJZXAALGGDIFOZ-UHFFFAOYSA-N
SMILES:NC1(CC1)C=2N=C(N)C=CN2
Synonyms:- 4-Pyrimidinamine, 2-(1-aminocyclopropyl)-
- 2-(1-Aminocyclopropyl)-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.