CAS 1159882-43-5

2-Cyclopropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

Description:

2-Cyclopropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both a pyridine and a pyrimidine moiety. This compound features a cyclopropyl group, contributing to its unique reactivity and potential biological activity. The tetrahydropyrido structure indicates that it contains saturated rings, which can influence its stability and solubility. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of nitrogen atoms in the rings can also affect the compound's electronic properties and interactions with biological targets. Additionally, the specific arrangement of substituents can lead to diverse chemical behaviors, including potential applications in drug development. As with many heterocycles, the synthesis and characterization of this compound would involve various analytical techniques to confirm its structure and purity. Overall, 2-Cyclopropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine represents a class of compounds that may hold promise in various chemical and pharmaceutical applications.

Formula: C₁₀H₁₃N₃

InChI: InChI=1S/C10H13N3/c1-2-7(1)10-12-5-8-3-4-11-6-9(8)13-10/h5,7,11H,1-4,6H2

InChI key: InChIKey=WFMOPNXLWDNLJU-UHFFFAOYSA-N

SMILES: C=1(N=C2C(=CN1)CCNC2)C3CC3

Synonyms:

• 2-Cyclopropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine
• Pyrido[3,4-d]pyrimidine, 2-cyclopropyl-5,6,7,8-tetrahydro-