
CAS 1159882-56-0
:5,6,7,8-Tetrahydro-2-(4-morpholinyl)pyrido[3,4-d]pyrimidine
Description:
5,6,7,8-Tetrahydro-2-(4-morpholinyl)pyrido[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the rings, contributing to its stability and solubility. The morpholine group attached to the pyridine moiety enhances its potential for biological activity, as morpholines are known for their ability to interact with various biological targets. The compound's molecular structure suggests it may exhibit properties such as moderate lipophilicity, which can influence its pharmacokinetics and bioavailability. Additionally, the presence of nitrogen atoms in the rings may contribute to its ability to form hydrogen bonds, potentially affecting its reactivity and interactions with other molecules. Overall, this compound is of interest in medicinal chemistry, particularly for its potential applications in drug development and therapeutic interventions.
Formula:C11H16N4O
InChI:InChI=1S/C11H16N4O/c1-2-12-8-10-9(1)7-13-11(14-10)15-3-5-16-6-4-15/h7,12H,1-6,8H2
InChI key:InChIKey=XVGYCDNXNFKDQK-UHFFFAOYSA-N
SMILES:C=1(N=C2C(=CN1)CCNC2)N3CCOCC3
Synonyms:- Pyrido[3,4-d]pyrimidine, 5,6,7,8-tetrahydro-2-(4-morpholinyl)-
- 5,6,7,8-Tetrahydro-2-(4-morpholinyl)pyrido[3,4-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.