CAS 1159908-19-6
:2-Chloro-N-[(3S,4S)-4-hydroxy-1-[(4-methylphenyl)sulfonyl]-3-pyrrolidinyl]-N-[(1R)-1-phenylethyl]acetamide
Description:
2-Chloro-N-[(3S,4S)-4-hydroxy-1-[(4-methylphenyl)sulfonyl]-3-pyrrolidinyl]-N-[(1R)-1-phenylethyl]acetamide, with CAS number 1159908-19-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a sulfonyl moiety, and multiple chiral centers. This compound is likely to exhibit specific stereochemical properties due to its chiral centers, influencing its biological activity and interactions. The presence of the sulfonyl group suggests potential applications in medicinal chemistry, possibly as a pharmacological agent. The hydroxyl group may contribute to hydrogen bonding capabilities, enhancing solubility and reactivity. Additionally, the compound's structural features indicate it may interact with biological targets, making it of interest in drug development. Its stability, solubility, and reactivity would depend on the surrounding conditions, such as pH and temperature. Overall, this compound represents a class of molecules that could have significant implications in therapeutic applications, particularly in the fields of pharmacology and medicinal chemistry.
Formula:C21H25ClN2O4S
InChI:InChI=1S/C21H25ClN2O4S/c1-15-8-10-18(11-9-15)29(27,28)23-13-19(20(25)14-23)24(21(26)12-22)16(2)17-6-4-3-5-7-17/h3-11,16,19-20,25H,12-14H2,1-2H3/t16-,19+,20+/m1/s1
InChI key:InChIKey=KFNCGGKMCZOBBV-UXPWSPDFSA-N
SMILES:N([C@H](C)C1=CC=CC=C1)(C(CCl)=O)[C@H]2CN(S(=O)(=O)C3=CC=C(C)C=C3)C[C@@H]2O
Synonyms:- Acetamide, 2-chloro-N-[(3S,4S)-4-hydroxy-1-[(4-methylphenyl)sulfonyl]-3-pyrrolidinyl]-N-[(1R)-1-phenylethyl]-
- 2-Chloro-N-[(3S,4S)-4-hydroxy-1-[(4-methylphenyl)sulfonyl]-3-pyrrolidinyl]-N-[(1R)-1-phenylethyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.