CAS 1159908-24-3

Methyl 3-amino-2,4-dichloro-5-fluorobenzoate

Description:

Methyl 3-amino-2,4-dichloro-5-fluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety with various substituents. The presence of amino, dichloro, and fluoro groups indicates that it is a halogenated and amine-containing derivative of benzoic acid. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms and the amino group, which can influence its solubility in polar solvents. The dichloro and fluoro substituents can also impart unique reactivity and stability characteristics, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound may participate in nucleophilic substitution reactions due to the presence of the amino group, while the halogen atoms can serve as leaving groups in certain reactions. Additionally, its structural features suggest potential biological activity, which could be explored in medicinal chemistry. Overall, Methyl 3-amino-2,4-dichloro-5-fluorobenzoate is a compound of interest due to its diverse functional groups and potential applications in synthetic chemistry.

Formula: C₈H₆Cl₂FNO₂

InChI: InChI=1S/C8H6Cl2FNO2/c1-14-8(13)3-2-4(11)6(10)7(12)5(3)9/h2H,12H2,1H3

InChI key: InChIKey=YQPXHTQHEFRTIN-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(Cl)C(N)=C(Cl)C(F)=C1

Synonyms:

• Benzoic acid, 3-amino-2,4-dichloro-5-fluoro-, methyl ester
• Methyl 3-amino-2,4-dichloro-5-fluorobenzoate

Methyl 3-amino-2,4-dichloro-5-fluorobenzoate

CAS: 1159908-24-3

Formula: C₈H₆Cl₂FNO₂

Purity: 97%

Molecular weight: 238.0431

Ref: IN-DA01DMAM

Methyl 3-amino-2,4-dichloro-5-fluorobenzoate

CAS: 1159908-24-3

Methyl 3-amino-2,4-dichloro-5-fluorobenzoate

Purity: 97%

Molecular weight: 238.04g/mol

Ref: 54-PC100920

Methyl 3-amino-2,4-dichloro-5-fluorobenzoate

CAS: 1159908-24-3

Purity: 97%

Molecular weight: 238.0399933

Ref: 10-F607614