CAS 1159937-09-3: 3,5-Bis(3,4-dimethoxyphenyl)-1H-pyrazole

Description: 3,5-Bis(3,4-dimethoxyphenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features two 3,4-dimethoxyphenyl groups attached to the 3 and 5 positions of the pyrazole ring, contributing to its structural complexity and potential biological activity. The presence of methoxy groups enhances its solubility and may influence its reactivity and interaction with biological targets. Typically, compounds like this are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to modulate biological pathways. The molecular structure suggests that it may exhibit interesting electronic properties and could be investigated for its role in various chemical reactions or as a ligand in coordination chemistry. Additionally, its unique arrangement of functional groups may impart specific characteristics such as antioxidant or anti-inflammatory activities, making it a candidate for further research in drug discovery and development.

Formula: C₁₉H₂₀N₂O₄

InChI: InChI=1S/C19H20N2O4/c1-22-16-7-5-12(9-18(16)24-3)14-11-15(21-20-14)13-6-8-17(23-2)19(10-13)25-4/h5-11H,1-4H3,(H,20,21)

InChI key: InChIKey=UTXQJLQWSOTTME-UHFFFAOYSA-N

SMILES: N=1NC(=CC1C=2C=CC(OC)=C(OC)C2)C=3C=CC(OC)=C(OC)C3

3,5-bis(3,4-dimethoxyphenyl)-1H-pyrazole

CAS: 1159937-09-3

• Molecular weight: 340.3789978027344

3,5-Bis(3,4-dimethoxyphenyl)-1H-pyrazole

CAS: 1159937-09-3

Versatile small molecule scaffold

• Formula: C₁₉H₂₀N₂O₄
• Purity: Min. 95%
• Molecular weight: 340.4 g/mol