CAS 1159937-12-8

3,5-Bis(2-methoxyphenyl)-1H-pyrazole

Description:

3,5-Bis(2-methoxyphenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features two 2-methoxyphenyl substituents at the 3 and 5 positions of the pyrazole ring, contributing to its unique chemical properties. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. Typically, compounds like this can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential for interactions with biological targets, possibly acting as ligands or inhibitors. Additionally, the compound's stability, melting point, and solubility characteristics would depend on the specific conditions and solvents used. As with many organic compounds, the synthesis and purification methods can significantly affect the yield and purity of the final product. Overall, 3,5-Bis(2-methoxyphenyl)-1H-pyrazole represents a class of compounds that may have applications in drug development and materials science.

Formula: C₁₇H₁₆N₂O₂

InChI: InChI=1S/C17H16N2O2/c1-20-16-9-5-3-7-12(16)14-11-15(19-18-14)13-8-4-6-10-17(13)21-2/h3-11H,1-2H3,(H,18,19)

InChI key: InChIKey=IPNGSQDMHLJZCE-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=2C=C(NN2)C3=C(OC)C=CC=C3)C=CC=C1

Synonyms:

• 1H-Pyrazole, 3,5-bis(2-methoxyphenyl)-
• 3,5-Bis(2-methoxyphenyl)-1H-pyrazole

3,5-Bis(2-methoxyphenyl)-1H-pyrazole

CAS: 1159937-12-8

Versatile small molecule scaffold

Formula: C₁₇H₁₆N₂O₂

Purity: Min. 95%

Molecular weight: 280.32 g/mol

Ref: 3D-JWB93712