CAS 1159937-19-5

3,5-Bis(4-bromophenyl)-4-methyl-1H-pyrazole

Description:

3,5-Bis(4-bromophenyl)-4-methyl-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features two 4-bromophenyl groups attached to the 3 and 5 positions of the pyrazole ring, contributing to its aromatic character and potential for various chemical interactions. The presence of the bromine substituents enhances its reactivity and may influence its electronic properties, making it of interest in medicinal chemistry and material science. The methyl group at the 4 position of the pyrazole ring adds to its steric and electronic profile. This compound may exhibit interesting biological activities, including potential anti-inflammatory or anticancer properties, due to the structural motifs present. Its solubility, stability, and reactivity can vary based on the solvent and conditions used, making it a subject of study in various chemical applications. Overall, 3,5-Bis(4-bromophenyl)-4-methyl-1H-pyrazole represents a versatile scaffold for further chemical exploration and development.

Formula: C₁₆H₁₂Br₂N₂

InChI: InChI=1S/C16H12Br2N2/c1-10-15(11-2-6-13(17)7-3-11)19-20-16(10)12-4-8-14(18)9-5-12/h2-9H,1H3,(H,19,20)

InChI key: InChIKey=RUHSHCMXEPMOKW-UHFFFAOYSA-N

SMILES: CC=1C(=NNC1C2=CC=C(Br)C=C2)C3=CC=C(Br)C=C3

Synonyms:

• 1H-Pyrazole, 3,5-bis(4-bromophenyl)-4-methyl-
• 3,5-Bis(4-bromophenyl)-4-methyl-1H-pyrazole