CAS 1159939-59-9
:3,5-Bis(4-fluorophenyl)-4-methyl-1H-pyrazole
Description:
3,5-Bis(4-fluorophenyl)-4-methyl-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of two 4-fluorophenyl groups at the 3 and 5 positions of the pyrazole ring significantly influences its chemical properties, including its reactivity and potential biological activity. The methyl group at the 4 position adds to its structural complexity and may affect its solubility and stability. This compound is typically synthesized through multi-step organic reactions, often involving the introduction of the fluorophenyl groups via electrophilic aromatic substitution. It may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry. Additionally, its fluorinated aromatic rings can enhance lipophilicity and metabolic stability, which are desirable traits in drug development. Overall, 3,5-Bis(4-fluorophenyl)-4-methyl-1H-pyrazole is a compound of interest in various fields, including pharmaceuticals and materials science.
Formula:C16H12F2N2
InChI:InChI=1S/C16H12F2N2/c1-10-15(11-2-6-13(17)7-3-11)19-20-16(10)12-4-8-14(18)9-5-12/h2-9H,1H3,(H,19,20)
InChI key:InChIKey=COAFAPZNHYXAHD-UHFFFAOYSA-N
SMILES:CC=1C(=NNC1C2=CC=C(F)C=C2)C3=CC=C(F)C=C3
Synonyms:- 1H-Pyrazole, 3,5-bis(4-fluorophenyl)-4-methyl-
- 3,5-Bis(4-fluorophenyl)-4-methyl-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.