CAS 1159976-37-0
:Ethyl 6-methyl-2-quinazolinecarboxylate
Description:
Ethyl 6-methyl-2-quinazolinecarboxylate is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a methyl group at the 6-position of the quinazoline ring influences its chemical properties and potential biological activity. Ethyl 6-methyl-2-quinazolinecarboxylate is typically synthesized through various organic reactions, often involving the condensation of appropriate precursors. It may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, this compound represents a valuable entity in the field of organic chemistry and drug development.
Formula:C12H12N2O2
InChI:InChI=1S/C12H12N2O2/c1-3-16-12(15)11-13-7-9-6-8(2)4-5-10(9)14-11/h4-7H,3H2,1-2H3
InChI key:InChIKey=FVFIWISFAUSWRI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC2=C(C=N1)C=C(C)C=C2
Synonyms:- Ethyl 6-methyl-2-quinazolinecarboxylate
- 2-Quinazolinecarboxylic acid, 6-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
