CAS 1159977-00-0
:3-Pyridinemethanol, 5,6-dimethyl-, 3-acetate, 1-oxide
Description:
3-Pyridinemethanol, 5,6-dimethyl-, 3-acetate, 1-oxide, identified by its CAS number 1159977-00-0, is a chemical compound that features a pyridine ring substituted with a hydroxymethyl group and an acetate group, along with a 1-oxide functional group. This compound is characterized by its heterocyclic structure, which contributes to its potential biological activity and reactivity. The presence of the dimethyl groups at the 5 and 6 positions of the pyridine ring can influence its steric and electronic properties, potentially affecting its solubility and interaction with biological targets. As an acetate derivative, it may exhibit ester-like characteristics, which can impact its stability and reactivity in various chemical environments. The 1-oxide functionality suggests the presence of an oxygen atom bonded to the nitrogen of the pyridine, which can enhance its polar nature and solubility in polar solvents. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C10H13NO3
InChI:InChI=1S/C10H13NO3/c1-7-4-10(6-14-9(3)12)5-11(13)8(7)2/h4-5H,6H2,1-3H3
InChI key:InChIKey=CSNXGEFOFOGJOZ-UHFFFAOYSA-N
SMILES:C(OC(C)=O)C=1C=C(C)C(C)=N(=O)C1
Synonyms:- 3-Pyridinemethanol, 5,6-dimethyl-, 3-acetate, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Acetoxymethyl-2,3-dimethylpyridine N-oxide
CAS:Controlled ProductApplications Intermediate in the preparation of Omeprazole metabolites
Formula:C10H13NO3Color and Shape:NeatMolecular weight:195.22
