CAS 1159977-06-6

Cyclohexyl[4-(phenylmethoxy)cyclohexyl]methanone

Description:

Cyclohexyl[4-(phenylmethoxy)cyclohexyl]methanone is an organic compound characterized by its complex structure, which includes cyclohexyl and phenyl groups. This compound features a ketone functional group, indicated by the presence of the methanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The phenylmethoxy substituent enhances its solubility in organic solvents and may influence its interaction with biological systems. Typically, compounds of this nature exhibit moderate to high lipophilicity, which can affect their pharmacokinetic properties if considered for medicinal chemistry applications. Additionally, the presence of multiple cyclic structures may impart rigidity to the molecule, potentially influencing its conformational dynamics. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds with similar structures often exhibit interesting chemical behavior, making them subjects of interest in various fields, including pharmaceuticals and materials science. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₂₀H₂₈O₂

InChI: InChI=1S/C20H28O2/c21-20(17-9-5-2-6-10-17)18-11-13-19(14-12-18)22-15-16-7-3-1-4-8-16/h1,3-4,7-8,17-19H,2,5-6,9-15H2

InChI key: InChIKey=LOOMVWCDSXMACW-UHFFFAOYSA-N

SMILES: C(=O)(C1CCC(OCC2=CC=CC=C2)CC1)C3CCCCC3

Synonyms:

• Cyclohexyl[4-(phenylmethoxy)cyclohexyl]methanone
• Methanone, cyclohexyl[4-(phenylmethoxy)cyclohexyl]-

4-Benzyloxy-cyclohexyl Ketone (Mixture of Diastereomers)

Controlled Product

CAS: 1159977-06-6

Applications 4-Benzyloxy-cyclohexyl Ketone _x000D_(Mixture of Diastereomers) (cas# 1159977-06-6 ) is a compound useful in organic synthesis.

Formula: C₂₀H₂₈O₂

Color and Shape: Neat

Molecular weight: 300.44

Ref: TR-B286325