CAS 1159977-20-4

5-(3-Chloropropyl)-10,11-dihydro-5H-dibenz[b,f]azepine-2-carboxaldehyde

Description:

5-(3-Chloropropyl)-10,11-dihydro-5H-dibenz[b,f]azepine-2-carboxaldehyde is a chemical compound characterized by its complex structure, which includes a dibenzazepine core, a chloropropyl substituent, and an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure and side chain. The presence of the chloropropyl group suggests potential reactivity and interactions typical of halogenated compounds, which can influence its solubility and biological activity. The aldehyde functional group is known for its reactivity, particularly in condensation reactions and as a potential electrophile. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties, as dibenzazepines are often explored for their effects on the central nervous system. Additionally, the specific arrangement of substituents can affect its binding affinity and selectivity for various biological targets. Overall, this compound represents a unique structure with potential applications in drug development and research.

Formula: C₁₈H₁₈ClNO

InChI: InChI=1S/C18H18ClNO/c19-10-3-11-20-17-5-2-1-4-15(17)7-8-16-12-14(13-21)6-9-18(16)20/h1-2,4-6,9,12-13H,3,7-8,10-11H2

InChI key: InChIKey=AAKKLVKYXRKPTL-UHFFFAOYSA-N

SMILES: C(CCCl)N1C=2C(=CC(C=O)=CC2)CCC=3C1=CC=CC3

Synonyms:

• 5-(3-Chloropropyl)-10,11-dihydro-5H-dibenz[b,f]azepine-2-carboxaldehyde
• 5H-Dibenz[b,f]azepine-2-carboxaldehyde, 5-(3-chloropropyl)-10,11-dihydro-

5-(3-Chloropropyl)-10,11-dihydro-2-formyl-5H-dibenz[b,f]azepine

Controlled Product

CAS: 1159977-20-4

Applications An intermediate in the preparation of Imipramine derivatives

Formula: C₁₈H₁₈ClNO

Color and Shape: Neat

Molecular weight: 299.79

Ref: TR-C379735